Products 71879-56-6

CAS 71879-56-6 is the registry number for 4-(Pyridin-4-yl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

4-pyridin-4-ylbutanoic acid;hydrochloride (CAS 71879-56-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 4-pyridin-4-ylbutanoic acid;hydrochloride. InChIKey: CYCQBYSNONAYRO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO2
Molecular weight201.65 g/mol
IUPAC name4-pyridin-4-ylbutanoic acid;hydrochloride
InChIKeyCYCQBYSNONAYRO-UHFFFAOYSA-N
SMILESC1=CN=CC=C1CCCC(=O)O.Cl

Computed by PubChem (NCBI)