CAS 383677-41-6 appears in our catalog under these names: Methyl 3-amino-4-methylbenzoate hydrochloride, 95%, Methyl 3-amino-4-methylbenzoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g.
Methyl 3-amino-4-methylbenzoate;hydrochloride (CAS 383677-41-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 3-amino-4-methylbenzoate;hydrochloride. InChIKey: JEVIQWWFGMLYGY-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 3-amino-4-methylbenzoate;hydrochloride |
| InChIKey | JEVIQWWFGMLYGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)