CAS 209533-97-1 appears in our catalog under these names: 2-(Dimethylamino)benzoic acid hydrochloride, 95%, 2-(Dimethylamino)benzoic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-(dimethylamino)benzoic acid;hydrochloride (CAS 209533-97-1) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-(dimethylamino)benzoic acid;hydrochloride. InChIKey: LHLPYWDZRLVNPA-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-(dimethylamino)benzoic acid;hydrochloride |
| InChIKey | LHLPYWDZRLVNPA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1C(=O)O.Cl |
Computed by PubChem (NCBI)