Products 1134776-39-8
CAS 1134776-39-8 appears in our catalog under these names: (R)-4-(1-Aminoethyl)benzoic acid hydrochloride, 95%, (R)-4-(1-Aminoethyl)benzoic acid hydrochloride, 97%, 97%, (R)-4-(1-Aminoethyl)benzoic acid hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
4-[(1R)-1-aminoethyl]benzoic acid;hydrochloride (CAS 1134776-39-8) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]benzoic acid;hydrochloride. InChIKey: GNWOFSYSPMCLJU-FYZOBXCZSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]benzoic acid;hydrochloride |
| InChIKey | GNWOFSYSPMCLJU-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)