cas: 2155875-05-9 — see every product listed under this CAS number, including other names
5-(Benzyloxy)pyridazine-3-carboxylic Acid, ≥95%, ≥95% (CAS 2155875-05-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12TAPY-100mg |
| cas | 2155875-05-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1019.60 Pln | |
| Chemat | 250mg | 1590.80 Pln | |
| Chemat | 1g | 3885.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-phenylmethoxypyridazine-3-carboxylic acid (CAS 2155875-05-9) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 5-phenylmethoxypyridazine-3-carboxylic acid. InChIKey: IEDCGILZSXRKPZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 5-phenylmethoxypyridazine-3-carboxylic acid |
| InChIKey | IEDCGILZSXRKPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=NN=C2)C(=O)O |
Computed by PubChem (NCBI)