cas: 499770-76-2 — see every product listed under this CAS number, including other names
5-(Bromomethyl)-1-methyl-1H-benzo(d)(1,2,3)triazole, 95% (CAS 499770-76-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A304390-5g |
| cas | 499770-76-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8194.48 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(bromomethyl)-1-methylbenzotriazole (CAS 499770-76-2) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 5-(bromomethyl)-1-methylbenzotriazole. InChIKey: OSUZHHPMRAIJDY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 5-(bromomethyl)-1-methylbenzotriazole |
| InChIKey | OSUZHHPMRAIJDY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)CBr)N=N1 |
Computed by PubChem (NCBI)