cas: 721428-34-8 — see every product listed under this CAS number, including other names
5-(Chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole 98% (CAS 721428-34-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A508474-250mg |
| cas | 721428-34-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 348.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A508474 |
5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole (CAS 721428-34-8) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole. InChIKey: LMZZSCWNPOUYES-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | LMZZSCWNPOUYES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCl)F |
Computed by PubChem (NCBI)