cas: 721428-34-8 — see every product listed under this CAS number, including other names
5-Chloromethyl-3-(4-fluoro-phenyl)-[1,2,4]oxadiazole, 97% (CAS 721428-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040626-1G |
| cas | 721428-34-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 310.33 Pln | |
| Fluorochem | 100g | 5110.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole (CAS 721428-34-8) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole. InChIKey: LMZZSCWNPOUYES-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | LMZZSCWNPOUYES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCl)F |
Computed by PubChem (NCBI)