cas: 1174323-34-2 — see every product listed under this CAS number, including other names
5-(Difluoromethoxy)picolinic acid 98% (CAS 1174323-34-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A776482-100mg |
| cas | 1174323-34-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3346.31 Pln | |
| Ambeed | 10g | 5960.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A776482 |
5-(difluoromethoxy)pyridine-2-carboxylic acid (CAS 1174323-34-2) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 5-(difluoromethoxy)pyridine-2-carboxylic acid. InChIKey: QOGGIPBAUKZCGU-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 5-(difluoromethoxy)pyridine-2-carboxylic acid |
| InChIKey | QOGGIPBAUKZCGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(F)F)C(=O)O |
Computed by PubChem (NCBI)