5-(Difluoromethoxy)picolinic acid, 98%
cas: 1174323-34-2 — see every product listed under this CAS number, including other names
5-(Difluoromethoxy)picolinic acid, 98% (CAS 1174323-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A776482-250mg |
| cas | 1174323-34-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 3045.94 Pln | |
| Ambeed | 10g | 5426.69 Pln | |
| BLDpharm | 100mg | 325.47 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1069.65 Pln | |
| BLDpharm | 5g | 3274.43 Pln | |
| BLDpharm | 10g | 5845.74 Pln | |
| Fluorochem | 100mg | 310.32 Pln | |
| Fluorochem | 250mg | 430.07 Pln | |
| Fluorochem | 1g | 1023.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5-(difluoromethoxy)pyridine-2-carboxylic acid (CAS 1174323-34-2) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 5-(difluoromethoxy)pyridine-2-carboxylic acid. InChIKey: QOGGIPBAUKZCGU-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO3 |
|---|---|
| Molecular weight | 189.12 g/mol |
| IUPAC name | 5-(difluoromethoxy)pyridine-2-carboxylic acid |
| InChIKey | QOGGIPBAUKZCGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1OC(F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(Difluoromethoxy)picolinic acid, 5-(difluoromethoxy)pyridine-2-carboxylic acid, 2-Pyridinecarboxylic acid, 5-(difluoromethoxy)-, 5-difluoromethoxypyridine-2-carboxylic acid, 5-?(difluoromethoxy)?picolinic acid, 5-(Difluoromethoxy)picolinicacid, 5-difluoromethoxy-pyridine-2-carboxylic acid, 5-(difluoromethoxy)-2-Pyridinecarboxylic acid