cas: 145122-43-6 — see every product listed under this CAS number, including other names
5-(Dihydrofuran-2(3H)-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 145122-43-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720997-1G |
| cas | 145122-43-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1627.57 Pln |
| delivery time | 3-4 weeks |
|---|
2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione (CAS 145122-43-6) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione. InChIKey: JSUMRUSDCOEXFQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione |
| InChIKey | JSUMRUSDCOEXFQ-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=C2CCCO2)C(=O)O1)C |
Computed by PubChem (NCBI)