Products 1138-60-9
CAS 1138-60-9 appears in our catalog under these names: Isopropylgallate, 95%, iso-Propyl gallate, Isopropyl 3,4,5-trihydroxybenzoate 97%, Isopropylgallate, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 2g, 1g, 500mg, 1000mg, 2000mg, 5000mg, 10000mg.
Propan-2-yl 3,4,5-trihydroxybenzoate (CAS 1138-60-9) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: propan-2-yl 3,4,5-trihydroxybenzoate. InChIKey: TXGSOSAONMOPDL-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | propan-2-yl 3,4,5-trihydroxybenzoate |
| InChIKey | TXGSOSAONMOPDL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C(=C1)O)O)O |
Computed by PubChem (NCBI)