CAS 145122-43-6 appears in our catalog under these names: 5-(Dihydrofuran-2(3h)-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%, 5-(Dihydrofuran-2(3H)-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, ≥95%, ≥95%, 5-(Dihydrofuran-2(3H)-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione (CAS 145122-43-6) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione. InChIKey: JSUMRUSDCOEXFQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,2-dimethyl-5-(oxolan-2-ylidene)-1,3-dioxane-4,6-dione |
| InChIKey | JSUMRUSDCOEXFQ-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=C2CCCO2)C(=O)O1)C |
Computed by PubChem (NCBI)