CAS 36873-96-8 appears in our catalog under these names: 2,3,5-Trimethoxybenzoic acid, 95%, 2,3,5-Trimethoxybenzoic acid, 95+%, 2,3,5-trimethoxybenzoic acid, 97%, 97%, 2,3,5-TRIMETHOXYBENZOIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
2,3,5-trimethoxybenzoic acid (CAS 36873-96-8) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,3,5-trimethoxybenzoic acid. InChIKey: SRLTVIITBRPPCB-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,3,5-trimethoxybenzoic acid |
| InChIKey | SRLTVIITBRPPCB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)