CAS 163428-90-8 is the registry number for 3,4-Dimethoxyphenylglyoxal hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(3,4-dimethoxyphenyl)-2-oxoacetaldehyde;hydrate (CAS 163428-90-8) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-2-oxoacetaldehyde;hydrate. InChIKey: HVXVAKHTLMPFDQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | HVXVAKHTLMPFDQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C=O)OC.O |
Computed by PubChem (NCBI)