Products 95110-10-4

CAS 95110-10-4 is the registry number for 2,6-Dimethoxyphenoxyacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2,6-dimethoxyphenoxy)acetic acid (CAS 95110-10-4) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2-(2,6-dimethoxyphenoxy)acetic acid. InChIKey: MCUFTNXSWDHDIS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O5
Molecular weight212.20 g/mol
IUPAC name2-(2,6-dimethoxyphenoxy)acetic acid
InChIKeyMCUFTNXSWDHDIS-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)OC)OCC(=O)O

Computed by PubChem (NCBI)