cas: 60792-88-3 — see every product listed under this CAS number, including other names
5-Acetyl-2-methoxyphenyl acetate, 97%, 97% (CAS 60792-88-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11F5GM-100mg |
| cas | 60792-88-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 664.40 Pln | |
| Chemat | 500mg | 1067.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(5-acetyl-2-methoxyphenyl) acetate (CAS 60792-88-3) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (5-acetyl-2-methoxyphenyl) acetate. InChIKey: TWPFICFACFZUQL-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (5-acetyl-2-methoxyphenyl) acetate |
| InChIKey | TWPFICFACFZUQL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)OC(=O)C |
Computed by PubChem (NCBI)