Products 60792-88-3
CAS 60792-88-3 appears in our catalog under these names: 1-[3-(ACETYLOXY)-4-METHOXYPHENYL]-ETHANONE, 97%, 5-Acetyl-2-methoxyphenyl acetate, 95%, 5-Acetyl-2-methoxyphenyl Acetate, 5-Acetyl-2-methoxyphenyl acetate, 97%. Offered by: Fluorochem, Combi-blocks, TRC, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(5-acetyl-2-methoxyphenyl) acetate (CAS 60792-88-3) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (5-acetyl-2-methoxyphenyl) acetate. InChIKey: TWPFICFACFZUQL-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (5-acetyl-2-methoxyphenyl) acetate |
| InChIKey | TWPFICFACFZUQL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)OC(=O)C |
Computed by PubChem (NCBI)