cas: 72016-73-0 — see every product listed under this CAS number, including other names
5-Amino-1-naphthonitrile 95% (CAS 72016-73-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148825-100mg |
| cas | 72016-73-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3279.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148825 |
5-aminonaphthalene-1-carbonitrile (CAS 72016-73-0) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 5-aminonaphthalene-1-carbonitrile. InChIKey: COMBRYCXLDMDCU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 5-aminonaphthalene-1-carbonitrile |
| InChIKey | COMBRYCXLDMDCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)N)C#N |
Computed by PubChem (NCBI)