cas: 50516-14-8 — see every product listed under this CAS number, including other names
5-Amino-2-(((benzyloxy)carbonyl)amino)-5-oxopentanoic acid, 98% (CAS 50516-14-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F869336-5G |
| cas | 50516-14-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1294.35 Pln | |
| Fluorochem | 25g | 2793.83 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 50516-14-8) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: JIMLDJNLXLMGLX-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | JIMLDJNLXLMGLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)