cas: 887267-84-7 — see every product listed under this CAS number, including other names
5-Amino-6-bromo-2,2-difluoro-1,3-benzodioxole 97% (CAS 887267-84-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A444194-100mg |
| cas | 887267-84-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 693.00 Pln | |
| Ambeed | 25g | 2545.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A444194 |
6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 887267-84-7) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: ZKILVLUCVYGVMI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | ZKILVLUCVYGVMI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Br)N |
Computed by PubChem (NCBI)