cas: 887267-84-7 — see every product listed under this CAS number, including other names
6-Bromo-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 95% (CAS 887267-84-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212052-250MG |
| cas | 887267-84-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 10g | 1091.30 Pln | |
| Fluorochem | 25g | 2320.03 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 887267-84-7) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: ZKILVLUCVYGVMI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | ZKILVLUCVYGVMI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Br)N |
Computed by PubChem (NCBI)