CAS 887267-84-7 appears in our catalog under these names: 5-Amino-6-bromo-2,2-difluorobenzodioxole, 98%, 6–Bromo–2,2–difluorobenzo(d)(1,3)dioxol–5–amine, 5-Amino-6-bromo-2,2-difluoro-1,3-benzodioxole 97%, 6-Bromo-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97%, 6-Bromo-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 887267-84-7) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: ZKILVLUCVYGVMI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | ZKILVLUCVYGVMI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Br)N |
Computed by PubChem (NCBI)