CAS 1211536-36-5 appears in our catalog under these names: 6-Bromo-2-(difluoromethyl)pyridine-3-carboxylic acid, 95%, 6-bromo-2-(difluoromethyl)pyridine-3-carboxylic acid, 95%, 95%, 6-Bromo-2-(difluoromethyl)nicotinic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 500mg, 250mg, 1g, 5g.
6-bromo-2-(difluoromethyl)pyridine-3-carboxylic acid (CAS 1211536-36-5) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 6-bromo-2-(difluoromethyl)pyridine-3-carboxylic acid. InChIKey: XYSNKLIXBHLKLC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 6-bromo-2-(difluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | XYSNKLIXBHLKLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(F)F)Br |
Computed by PubChem (NCBI)