Products 2092001-02-8
CAS 2092001-02-8 is the registry number for 3-bromo-1,4-difluoro-2-methyl-5-nitrobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-1,4-difluoro-2-methyl-5-nitrobenzene (CAS 2092001-02-8) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 3-bromo-1,4-difluoro-2-methyl-5-nitrobenzene. InChIKey: GSGTXUYQPURQII-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 3-bromo-1,4-difluoro-2-methyl-5-nitrobenzene |
| InChIKey | GSGTXUYQPURQII-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Br)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)