cas: 887267-84-7 — see every product listed under this CAS number, including other names
6-Bromo-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 97%, 97% (CAS 887267-84-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115645-100mg |
| cas | 887267-84-7 |
| size | 100mg |
| availability | 33.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 467.60 Pln | |
| Chemat | 10g | 875.60 Pln | |
| Chemat | 25g | 2090.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 887267-84-7) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: ZKILVLUCVYGVMI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 6-bromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | ZKILVLUCVYGVMI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)Br)N |
Computed by PubChem (NCBI)