cas: 23145-16-6 — see every product listed under this CAS number, including other names
5-Bromo-1-benzofuran-2-carbaldehyde, 97% (CAS 23145-16-6) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC31204CB |
| cas | 23145-16-6 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 621.08 Pln | |
| Thermo Scientific | 1g | 824.71 Pln | |
| Thermo Scientific | 5g | 3237.75 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-bromo-1-benzofuran-2-carbaldehyde (CAS 23145-16-6) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-1-benzofuran-2-carbaldehyde. InChIKey: UPEGFMDITWHVHV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-1-benzofuran-2-carbaldehyde |
| InChIKey | UPEGFMDITWHVHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C=O |
Computed by PubChem (NCBI)