cas: 23145-16-6 — see every product listed under this CAS number, including other names
5-Bromobenzo[b]furan-2-carbaldehyde, 98% (CAS 23145-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034120-100MG |
| cas | 23145-16-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1695.25 Pln | |
| Fluorochem | 10g | 2663.66 Pln | |
| Fluorochem | 25g | 4954.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-1-benzofuran-2-carbaldehyde (CAS 23145-16-6) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-1-benzofuran-2-carbaldehyde. InChIKey: UPEGFMDITWHVHV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-1-benzofuran-2-carbaldehyde |
| InChIKey | UPEGFMDITWHVHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C=O |
Computed by PubChem (NCBI)