cas: 400071-95-6 — see every product listed under this CAS number, including other names
5-Bromo-1-methyl-1H-indole-3-carboxylic acid, 97%, 97% (CAS 400071-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9MM-100mg |
| cas | 400071-95-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 10g | 693.20 Pln | |
| Chemat | 25g | 1557.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-methylindole-3-carboxylic acid (CAS 400071-95-6) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 5-bromo-1-methylindole-3-carboxylic acid. InChIKey: WQZLFFJMRKTCMU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 5-bromo-1-methylindole-3-carboxylic acid |
| InChIKey | WQZLFFJMRKTCMU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)