CAS 89245-41-0 appears in our catalog under these names: 2-(4-Bromo-1H-indol-3-yl)acetic acid, 98%, 4–Bromoindole–3–acetic Acid, 4-Bromoindole-3-acetic Acid 98%, 2-(4-Bromo-1H-indol-3-yl)acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 25g.
2-(4-bromo-1H-indol-3-yl)acetic acid (CAS 89245-41-0) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(4-bromo-1H-indol-3-yl)acetic acid. InChIKey: AQIDQZFQDRENOY-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(4-bromo-1H-indol-3-yl)acetic acid |
| InChIKey | AQIDQZFQDRENOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CC(=O)O |
Computed by PubChem (NCBI)