cas: 938458-97-0 — see every product listed under this CAS number, including other names
5-Bromo-2-(methoxymethyl)benzo[d]oxazole, ≥97%, ≥97% (CAS 938458-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117CQA-1g |
| cas | 938458-97-0 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 1638.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-(methoxymethyl)-1,3-benzoxazole (CAS 938458-97-0) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 5-bromo-2-(methoxymethyl)-1,3-benzoxazole. InChIKey: LMBMCMJRMKBCEZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 5-bromo-2-(methoxymethyl)-1,3-benzoxazole |
| InChIKey | LMBMCMJRMKBCEZ-UHFFFAOYSA-N |
| SMILES | COCC1=NC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)