cas: 949014-42-0 — see every product listed under this CAS number, including other names
5-Bromo-2-fluoro-4-methoxybenzoic acid, 96% (CAS 949014-42-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229675-250MG |
| cas | 949014-42-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 2887.54 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-fluoro-4-methoxybenzoic acid (CAS 949014-42-0) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methoxybenzoic acid. InChIKey: DSLNYARFEZMGKA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methoxybenzoic acid |
| InChIKey | DSLNYARFEZMGKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C(=O)O)Br |
Computed by PubChem (NCBI)