5-Bromo-2-nitroaniline, 97%, 97%
cas: 5228-61-5 — see every product listed under this CAS number, including other names
5-Bromo-2-nitroaniline, 97%, 97% (CAS 5228-61-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11458T-1g |
| cas | 5228-61-5 |
| size | 1g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 50g | 242.00 Pln | |
| Chemat | 100g | 419.60 Pln | |
| Chemat | 250g | 947.60 Pln | |
| Chemat | 500g | 1891.20 Pln | |
| Chemat | 1kg | 2997.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-nitroaniline (CAS 5228-61-5) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-2-nitroaniline. InChIKey: RMIFLIVHJLREFJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-2-nitroaniline |
| InChIKey | RMIFLIVHJLREFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)