CAS 5228-61-5 appears in our catalog under these names: 5-Bromo-2-nitroaniline 98%, 5-Bromo-2-nitroaniline, 95%, 5-Bromo-2-nitroaniline, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g, 1kg.
5-bromo-2-nitroaniline (CAS 5228-61-5) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 5-bromo-2-nitroaniline. InChIKey: RMIFLIVHJLREFJ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 5-bromo-2-nitroaniline |
| InChIKey | RMIFLIVHJLREFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)