cas: 39856-50-3 — see every product listed under this CAS number, including other names
5-Bromo-2-nitropyridine, 98%, 98% (CAS 39856-50-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 5kg, 10kg, 25kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11458V-5g |
| cas | 39856-50-3 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 500g | 470.40 Pln | |
| Chemat | 5kg | 3600.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-nitropyridine (CAS 39856-50-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 5-bromo-2-nitropyridine. InChIKey: ATXXLNCPVSUCNK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)