cas: 39856-50-3 — see every product listed under this CAS number, including other names
5-Bromo-2-nitropyridine, 97% (CAS 39856-50-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043668-5G |
| cas | 39856-50-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 570.65 Pln | |
| Fluorochem | 1kg | 1080.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-bromo-2-nitropyridine (CAS 39856-50-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 5-bromo-2-nitropyridine. InChIKey: ATXXLNCPVSUCNK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)