cas: 39856-50-3 — see every product listed under this CAS number, including other names
5-Bromo-2-nitropyridine, 99.96% (CAS 39856-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1 kg, 25 g, 100 g, 50 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-59228-1 kg |
| cas | 39856-50-3 |
| size | 1 kg |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 kg | 1248.49 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 100 g | 361.49 Pln | |
| MedChemExpress | 50 g | 287.18 Pln | |
| MedChemExpress | 500 g | 825.89 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.96% |
5-bromo-2-nitropyridine (CAS 39856-50-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 5-bromo-2-nitropyridine. InChIKey: ATXXLNCPVSUCNK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)