cas: 39856-50-3 — see every product listed under this CAS number, including other names
5-Bromo-2-nitropyridine, 99% (CAS 39856-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 398640010 |
| cas | 39856-50-3 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 106.02 Pln | |
| Thermo Scientific (Acros) | 5g | 327.40 Pln | |
| Sigma-Aldrich | 5G | 283.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
5-bromo-2-nitropyridine (CAS 39856-50-3) is a chemical compound with the molecular formula C5H3BrN2O2 and a molecular weight of 202.99 g/mol. IUPAC name: 5-bromo-2-nitropyridine. InChIKey: ATXXLNCPVSUCNK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O2 |
|---|---|
| Molecular weight | 202.99 g/mol |
| IUPAC name | 5-bromo-2-nitropyridine |
| InChIKey | ATXXLNCPVSUCNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)