CAS 82104-66-3 appears in our catalog under these names: 5-Bromo-2-phenylisoindoline-1,3-dione, 95%, 95%, 5-Bromo-2-phenylisoindoline-1,3-dione, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
5-bromo-2-phenylisoindole-1,3-dione (CAS 82104-66-3) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 5-bromo-2-phenylisoindole-1,3-dione. InChIKey: VIDLHMORTSMJKV-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 5-bromo-2-phenylisoindole-1,3-dione |
| InChIKey | VIDLHMORTSMJKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)