CAS 17024-21-4 is the registry number for 9-bromo-10-nitrophenanthrene, 97%(GC-MS),RG, 97%(GC-MS),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
9-bromo-10-nitrophenanthrene (CAS 17024-21-4) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 9-bromo-10-nitrophenanthrene. InChIKey: XHJCHUVWJCDJPN-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 9-bromo-10-nitrophenanthrene |
| InChIKey | XHJCHUVWJCDJPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C(=C2[N+](=O)[O-])Br |
Computed by PubChem (NCBI)