CAS 53463-67-5 is the registry number for 2-(3-Bromophenyl)-4h-3,1-benzoxazin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(3-bromophenyl)-3,1-benzoxazin-4-one (CAS 53463-67-5) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 2-(3-bromophenyl)-3,1-benzoxazin-4-one. InChIKey: PLJJOOVEIBZBDF-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 2-(3-bromophenyl)-3,1-benzoxazin-4-one |
| InChIKey | PLJJOOVEIBZBDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)