CAS 19357-21-2 is the registry number for 2-(2-Bromophenyl)-1H-isoindole-1,3(2H)-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
2-(2-bromophenyl)isoindole-1,3-dione (CAS 19357-21-2) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 2-(2-bromophenyl)isoindole-1,3-dione. InChIKey: BOBLWXRWKFBQTD-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 2-(2-bromophenyl)isoindole-1,3-dione |
| InChIKey | BOBLWXRWKFBQTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)