CAS 1258498-77-9 is the registry number for Benzo(d)oxazol-2-yl(4-bromophenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1,3-benzoxazol-2-yl-(4-bromophenyl)methanone (CAS 1258498-77-9) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 1,3-benzoxazol-2-yl-(4-bromophenyl)methanone. InChIKey: UCMHKNFMLFTZBU-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 1,3-benzoxazol-2-yl-(4-bromophenyl)methanone |
| InChIKey | UCMHKNFMLFTZBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)