CAS 19357-22-3 is the registry number for 2-(3-Bromo-phenyl)-isoindole-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)isoindole-1,3-dione (CAS 19357-22-3) is a chemical compound with the molecular formula C14H8BrNO2 and a molecular weight of 302.12 g/mol. IUPAC name: 2-(3-bromophenyl)isoindole-1,3-dione. InChIKey: SMVJGKRXJINAFW-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO2 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | 2-(3-bromophenyl)isoindole-1,3-dione |
| InChIKey | SMVJGKRXJINAFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)