cas: 1784871-38-0 — see every product listed under this CAS number, including other names
5-Bromo-3-isopropyl-2-methyl-3H-imidazo(4,5-b)pyridine, 95% (CAS 1784871-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A340107-1g |
| cas | 1784871-38-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6970.60 Pln | |
| AmBeed | 5g | 20381.20 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine (CAS 1784871-38-0) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 5-bromo-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine. InChIKey: KARQRQWTKJYTON-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 5-bromo-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine |
| InChIKey | KARQRQWTKJYTON-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)N=C(C=C2)Br |
Computed by PubChem (NCBI)