CAS 2654003-17-3 is the registry number for 8-Bromo-3-isopropyl-6-methylimidazo[1,2-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-methyl-3-propan-2-ylimidazo[1,2-a]pyrazine (CAS 2654003-17-3) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 8-bromo-6-methyl-3-propan-2-ylimidazo[1,2-a]pyrazine. InChIKey: HRCLSCJIEDPBNJ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 8-bromo-6-methyl-3-propan-2-ylimidazo[1,2-a]pyrazine |
| InChIKey | HRCLSCJIEDPBNJ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CN=C2C(=N1)Br)C(C)C |
Computed by PubChem (NCBI)