cas: 1052114-83-6 — see every product listed under this CAS number, including other names
5-Bromo-4-hydroxynicotinic acid, 97% (CAS 1052114-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211025-100MG |
| cas | 1052114-83-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 500mg | 341.56 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 2871.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-4-oxo-1H-pyridine-3-carboxylic acid (CAS 1052114-83-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 5-bromo-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: GZZLALVERDWLIO-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO3 |
|---|---|
| Molecular weight | 218.00 g/mol |
| IUPAC name | 5-bromo-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | GZZLALVERDWLIO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CN1)Br)C(=O)O |
Computed by PubChem (NCBI)