cas: 118897-99-7 — see every product listed under this CAS number, including other names
5-Bromo-6-fluoroindoline-2,3-dione 95% (CAS 118897-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116825-100mg |
| cas | 118897-99-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116825 |
5-bromo-6-fluoro-1H-indole-2,3-dione (CAS 118897-99-7) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 5-bromo-6-fluoro-1H-indole-2,3-dione. InChIKey: LNXMNYMNZYJVFX-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1H-indole-2,3-dione |
| InChIKey | LNXMNYMNZYJVFX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)NC(=O)C2=O |
Computed by PubChem (NCBI)