CAS 118897-99-7 appears in our catalog under these names: 5-Bromo-6-fluoro-1h-indole-2,3-dione, 95%, 5–Bromo–6–fluoroindoline–2,3–dione, 5-Bromo-6-fluoroindoline-2,3-dione, 5-Bromo-6-fluoroindoline-2,3-dione, 95%, 95%, 5-Bromo-6-fluoroindoline-2,3-dione, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 25g, 1g, 5g, 100mg, 2,5g.
5-bromo-6-fluoro-1H-indole-2,3-dione (CAS 118897-99-7) is a chemical compound with the molecular formula C8H3BrFNO2 and a molecular weight of 244.02 g/mol. IUPAC name: 5-bromo-6-fluoro-1H-indole-2,3-dione. InChIKey: LNXMNYMNZYJVFX-UHFFFAOYSA-N.
| Molecular formula | C8H3BrFNO2 |
|---|---|
| Molecular weight | 244.02 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1H-indole-2,3-dione |
| InChIKey | LNXMNYMNZYJVFX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)F)NC(=O)C2=O |
Computed by PubChem (NCBI)