cas: 944887-82-5 — see every product listed under this CAS number, including other names
5-Bromo-6-methylbenzo[d]thiazol-2-amine 95% (CAS 944887-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A418674-250mg |
| cas | 944887-82-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1482.88 Pln | |
| Ambeed | 5g | 4597.88 Pln | |
| Ambeed | 10g | 7991.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A418674 |
5-bromo-6-methyl-1,3-benzothiazol-2-amine (CAS 944887-82-5) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 5-bromo-6-methyl-1,3-benzothiazol-2-amine. InChIKey: LHFKOJQPISWLAY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 5-bromo-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | LHFKOJQPISWLAY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)N=C(S2)N |
Computed by PubChem (NCBI)