cas: 944887-82-5 — see every product listed under this CAS number, including other names
5-Bromo-6-methylbenzo[d]thiazol-2-amine, 95%, 95% (CAS 944887-82-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H7D6-250mg |
| cas | 944887-82-5 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 717.20 Pln | |
| Chemat | 1g | 1696.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-6-methyl-1,3-benzothiazol-2-amine (CAS 944887-82-5) is a chemical compound with the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. IUPAC name: 5-bromo-6-methyl-1,3-benzothiazol-2-amine. InChIKey: LHFKOJQPISWLAY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2S |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 5-bromo-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | LHFKOJQPISWLAY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)N=C(S2)N |
Computed by PubChem (NCBI)